formaldehyde,phenol,2,4,4-trimethylpent-1-ene structure
|
Common Name | formaldehyde,phenol,2,4,4-trimethylpent-1-ene | ||
|---|---|---|---|---|
| CAS Number | 67786-10-1 | Molecular Weight | 236.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | formaldehyde,phenol,2,4,4-trimethylpent-1-ene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O2 |
|---|---|
| Molecular Weight | 236.35000 |
| Exact Mass | 236.17800 |
| PSA | 37.30000 |
| LogP | 4.84190 |
| InChIKey | BETIDSUPPSAZRV-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(C)(C)C.C=O.Oc1ccccc1 |
| Diisobutylene,formaldehyde,phenol polymer |
| 2,4,4-trimethylpent-1-ene |
| Phenol,formaldehyde,diisobutylene polymer |
| Formaldehyde,polymer with phenol and 2,4,4-trimethyl-1-pentene |
| Diisobutylene,phenol,formaldehyde polymer |