Menthone 1,2-glycerol ketal structure
|
Common Name | Menthone 1,2-glycerol ketal | ||
|---|---|---|---|---|
| CAS Number | 67785-70-0 | Molecular Weight | 228.328 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 338.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7±23.7 °C | |
| Name | Menthone 1,2-glycerol ketal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.7±27.0 °C at 760 mmHg |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.328 |
| Flash Point | 158.7±23.7 °C |
| Exact Mass | 228.172546 |
| PSA | 38.69000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | GECFTYLLVUKXOY-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C2(C1)OCC(O)CO2 |
| 1,5-Dioxaspiro[5.5]undecan-3-ol, 10-methyl-7-(1-methylethyl)- |
| 7-Isopropyl-10-methyl-1,5-dioxaspiro[5.5]undecan-3-ol |
| 1,5-Dioxaspiro(5.5)undecan-3-ol,10-methyl-7-(1-methylethyl) |
| 1,5-Dioxaspiro(5.5)undecan-3-ol, 10-methyl-7-(1-methylethyl)- |
| Menthone cyclic ketal with 1,2,3 propanetriol |
| 10-Methyl-7-(1-methylethyl)-1,5-dioxaspiro[5.5]undecan-3-ol |
| 10-methyl-7-propan-2-yl-1,5-dioxaspiro[5.5]undecan-3-ol |