2H-benzotriazole,formaldehyde,2-methylundecan-2-amine
Modify Date: 2025-09-16 16:04:46
2H-benzotriazole,formaldehyde,2-methylundecan-2-amine structure
|
Common Name | 2H-benzotriazole,formaldehyde,2-methylundecan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 67762-69-0 | Molecular Weight | 334.49900 | |
| Density | N/A | Boiling Point | 243.5ºC at 760 mmHg | |
| Molecular Formula | C19H34N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.6ºC | |
| Name | 2H-benzotriazole,formaldehyde,2-methylundecan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 243.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.49900 |
| Flash Point | 96.6ºC |
| Exact Mass | 334.27300 |
| PSA | 84.66000 |
| LogP | 5.97360 |
| InChIKey | CEJWLESWBURBPZ-UHFFFAOYSA-N |
| SMILES | C=O.CCCCCCCCCC(C)(C)N.c1ccc2n[nH]nc2c1 |
| tert-Dodecylformaldimine tolyltriazole condensate |
| Formaldehyde,reaction products with 1H-benzotriazole and tert-dodecylamine |