2,4-DINITRO-1,8-NAPHTHALENEDIOL structure
|
Common Name | 2,4-DINITRO-1,8-NAPHTHALENEDIOL | ||
|---|---|---|---|---|
| CAS Number | 67708-10-5 | Molecular Weight | 250.16400 | |
| Density | 1.736g/cm3 | Boiling Point | 401.4ºC at 760 mmHg | |
| Molecular Formula | C10H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 2,4-dinitronaphthalene-1,8-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.736g/cm3 |
|---|---|
| Boiling Point | 401.4ºC at 760 mmHg |
| Molecular Formula | C10H6N2O6 |
| Molecular Weight | 250.16400 |
| Flash Point | 175.4ºC |
| Exact Mass | 250.02300 |
| PSA | 132.10000 |
| LogP | 3.11380 |
| Index of Refraction | 1.788 |
| InChIKey | DYQGJEQFJSIIQP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2cccc(O)c2c1O |
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~%
2,4-DINITRO-1,8... CAS#:67708-10-5 |
| Literature: Calvet; Carnero Journal of the Chemical Society, 1936 , p. 556,559 |
|
~%
2,4-DINITRO-1,8... CAS#:67708-10-5 |
| Literature: Calvet; Carnero Journal of the Chemical Society, 1936 , p. 556,559 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dinitro-1,8-napthalindiol |
| 1,8-Naphthalenediol,2,4-dinitro |
| 2.4-Dinitro-1.8-dihydroxy-naphthalin |
| 2,4-DINITRO-1,8-NAPHTHALENEDIOL |
| 2,4-dinitro-naphthalene-1,8-diol |
| 2,4-Dinitro-naphthalin-1,8-diol |