AKOS B004827
Modify Date: 2025-10-02 11:42:58
AKOS B004827 structure
|
Common Name | AKOS B004827 | ||
|---|---|---|---|---|
| CAS Number | 677012-43-0 | Molecular Weight | 289.07900 | |
| Density | 1.638g/cm3 | Boiling Point | 428.2ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 2-(2-bromo-4-formyl-6-methoxyphenoxy)acetic acid |
|---|
| Density | 1.638g/cm3 |
|---|---|
| Boiling Point | 428.2ºC at 760 mmHg |
| Molecular Formula | C10H9BrO5 |
| Molecular Weight | 289.07900 |
| Flash Point | 212.8ºC |
| Exact Mass | 287.96300 |
| PSA | 72.83000 |
| LogP | 1.73360 |
| Index of Refraction | 1.598 |
| InChIKey | PSNAZEXVUPWIHQ-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(Br)c1OCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |