4-(3,4-Dichlorophenoxy)aniline
Modify Date: 2025-11-08 15:39:48
4-(3,4-Dichlorophenoxy)aniline structure
|
Common Name | 4-(3,4-Dichlorophenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 67651-53-0 | Molecular Weight | 254.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-(3,4-Dichlorophenoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9Cl2NO |
|---|---|
| Molecular Weight | 254.11200 |
| Exact Mass | 253.00600 |
| PSA | 35.25000 |
| LogP | 4.94910 |
| InChIKey | BRHDZZRNYSNPSO-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| HS Code | 2922299090 |
|---|
|
~32%
4-(3,4-Dichloro... CAS#:67651-53-0 |
| Literature: JANSSEN PHARMACEUTICA, N.V. Patent: WO2005/44810 A1, 2005 ; Location in patent: Page/Page column 54 ; WO 2005/044810 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,4-dichloro-phenoxy)phenylamine |
| 4-(3,4-Dichlorophenoxy)benzenamine |
| 4-{[3,4-dichlorophenyl]oxy}aniline |