WAY-225588
Modify Date: 2024-04-05 16:43:38
WAY-225588 structure
|
Common Name | WAY-225588 | ||
|---|---|---|---|---|
| CAS Number | 6765-52-2 | Molecular Weight | 277.3205 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 605.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.7±31.5 °C | |
Use of WAY-225588inhibitors of G protein coupled receptor 6 kinase (GRK6) |
| Name | WAY-225588 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 605.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.3205 |
| Flash Point | 319.7±31.5 °C |
| Exact Mass | 317.105194 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | IVAVELBVHXCUDH-UHFFFAOYSA-N |
| SMILES | O=C(CC1(O)C(=O)Nc2ccccc21)c1ccc2ccccc2c1 |
| 2H-Indol-2-one, 1,3-dihydro-3-hydroxy-3-[2-(2-naphthalenyl)-2-oxoethyl]- |
| 3-Hydroxy-3-[2-(2-naphthyl)-2-oxoethyl]-1,3-dihydro-2H-indol-2-one |