2-(5,6-dimethyl-1H-benzoimidazol-2-yl)propan-2-ol structure
|
Common Name | 2-(5,6-dimethyl-1H-benzoimidazol-2-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 6761-75-7 | Molecular Weight | 204.26800 | |
| Density | 1.165g/cm3 | Boiling Point | 419.3ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.4ºC | |
| Name | 2-(5,6-dimethyl-1H-benzo[d]imidazol-2-yl)propan-2-ol |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 419.3ºC at 760 mmHg |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.26800 |
| Flash Point | 207.4ºC |
| Exact Mass | 204.12600 |
| PSA | 48.91000 |
| LogP | 2.40710 |
| Index of Refraction | 1.619 |
| InChIKey | LMSCYAAQLBYOQS-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc(C(C)(C)O)[nH]c2cc1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |