(2-carbonochloridoylphenyl) decanoate
Modify Date: 2025-09-19 18:17:24
(2-carbonochloridoylphenyl) decanoate structure
|
Common Name | (2-carbonochloridoylphenyl) decanoate | ||
|---|---|---|---|---|
| CAS Number | 675832-37-8 | Molecular Weight | 310.81600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-carbonochloridoylphenyl) decanoate |
|---|
| Molecular Formula | C17H23ClO3 |
|---|---|
| Molecular Weight | 310.81600 |
| Exact Mass | 310.13400 |
| PSA | 43.37000 |
| LogP | 5.11170 |
| InChIKey | SSLNSZJVLXFWCY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Oc1ccccc1C(=O)Cl |
|
~%
(2-carbonochlor... CAS#:675832-37-8 |
| Literature: THE PROCTER and GAMBLE COMPANY Patent: WO2004/26821 A2, 2004 ; Location in patent: Page 16 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |