CHEMBRDG-BB 4013147
Modify Date: 2025-09-27 12:22:11
CHEMBRDG-BB 4013147 structure
|
Common Name | CHEMBRDG-BB 4013147 | ||
|---|---|---|---|---|
| CAS Number | 675596-28-8 | Molecular Weight | 220.65200 | |
| Density | 1.219g/cm3 | Boiling Point | 344.3ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162ºC | |
| Name | 1-[5-(2-chlorophenyl)furan-2-yl]ethanone |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 344.3ºC at 760 mmHg |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.65200 |
| Flash Point | 162ºC |
| Exact Mass | 220.02900 |
| PSA | 30.21000 |
| LogP | 3.80260 |
| Index of Refraction | 1.554 |
| InChIKey | OQKZBDRVDZZGAC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccccc2Cl)o1 |
| HS Code | 2932190090 |
|---|
|
~45%
CHEMBRDG-BB 4013147 CAS#:675596-28-8 |
| Literature: Bencze, Laszlo Csaba; Paizs, Csaba; Tosa, Monica Ioana; Irimie, Florin Dan Tetrahedron Asymmetry, 2010 , vol. 21, # 3 p. 356 - 364 |
|
~%
CHEMBRDG-BB 4013147 CAS#:675596-28-8 |
| Literature: Trif, Maria; Kall, Noemi Hajnalka; Naghi, Mara Ana; Bencze, Laszl Csaba Biocatalysis and Biotransformation, 2012 , vol. 30, # 2 p. 177 - 183 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |