Benzyl (2-hydroxy-1-phenylethyl)carbamate structure
|
Common Name | Benzyl (2-hydroxy-1-phenylethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 67553-20-2 | Molecular Weight | 271.311 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8±28.7 °C | |
| Name | benzyl N-(2-hydroxy-1-phenylethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.7±45.0 °C at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.311 |
| Flash Point | 237.8±28.7 °C |
| Exact Mass | 271.120850 |
| PSA | 62.05000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | IWSCPMJLIZGTHY-UHFFFAOYSA-N |
| SMILES | O=C(NC(CO)c1ccccc1)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-(2-hydroxy-1-phenylethyl)-, phenylmethyl ester |
| Benzyl (2-hydroxy-1-phenylethyl)carbamate |