N-ethyl-2-(5-nitrofuran-2-yl)prop-2-enamide structure
|
Common Name | N-ethyl-2-(5-nitrofuran-2-yl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 6755-16-4 | Molecular Weight | 210.18700 | |
| Density | 1.281g/cm3 | Boiling Point | 421.9ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | N-ethyl-2-(5-nitrofuran-2-yl)prop-2-enamide |
|---|
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 421.9ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 208.9ºC |
| Exact Mass | 210.06400 |
| PSA | 91.55000 |
| LogP | 2.70060 |
| Index of Refraction | 1.57 |
| InChIKey | NXRVNGLQRJEAOH-HWKANZROSA-N |
| SMILES | CCNC(=O)C=Cc1ccc([N+](=O)[O-])o1 |
|
~%
N-ethyl-2-(5-ni... CAS#:6755-16-4 |
| Literature: Saikachi; Suzuki Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 693,695 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |