[2-(diethylamino)-2-oxoethyl] 2-methylbenzoate structure
|
Common Name | [2-(diethylamino)-2-oxoethyl] 2-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 6755-00-6 | Molecular Weight | 249.30600 | |
| Density | 1.081g/cm3 | Boiling Point | 386.1ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.3ºC | |
| Name | [2-(diethylamino)-2-oxoethyl] 2-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 386.1ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 187.3ºC |
| Exact Mass | 249.13600 |
| PSA | 46.61000 |
| LogP | 2.02020 |
| Index of Refraction | 1.517 |
| InChIKey | BPSNFPPAMWTSNU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccccc1C |
| o-Toluic acid,ester with N,N-diethylglycolamide |