1-methoxy-2-methyl-4-nitronaphthalene structure
|
Common Name | 1-methoxy-2-methyl-4-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 67545-39-5 | Molecular Weight | 217.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-2-methyl-4-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO3 |
|---|---|
| Molecular Weight | 217.22100 |
| Exact Mass | 217.07400 |
| PSA | 55.05000 |
| LogP | 3.58820 |
| InChIKey | RDSZAFTZNZZBIU-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc([N+](=O)[O-])c2ccccc12 |
|
~%
1-methoxy-2-met... CAS#:67545-39-5 |
| Literature: Tryon; Brown; Kharasch Journal of the American Chemical Society, 1948 , vol. 70, p. 2003 |
|
~%
1-methoxy-2-met... CAS#:67545-39-5 |
| Literature: Tryon; Brown; Kharasch Journal of the American Chemical Society, 1948 , vol. 70, p. 2003 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-1-methoxy-2-methyl-naphthalin |
| 4-Nitro-2-methyl-1-methoxynaphthalin |
| Naphthalene,1-methoxy-2-methyl-4-nitro |