Telekin structure
|
Common Name | Telekin | ||
|---|---|---|---|---|
| CAS Number | 6752-90-5 | Molecular Weight | 248.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TelekinTelekin is an eucalyptus-type sesquiterpene lactone compound found in Carpesium divaricatum. Telekin can activate mitochondria-mediated cell apoptosis and has anticancer activity[1]. |
| Name | Telekin |
|---|
| Description | Telekin is an eucalyptus-type sesquiterpene lactone compound found in Carpesium divaricatum. Telekin can activate mitochondria-mediated cell apoptosis and has anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H20O3 |
|---|---|
| Molecular Weight | 248.32 |
| InChIKey | LIDPBIULZNRIJE-QHSBEEBCSA-N |
| SMILES | C=C1C(=O)OC2CC3(C)CCCC(=C)C3(O)CC12 |