(3Z,5Z,7Z,9Z)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one structure
|
Common Name | (3Z,5Z,7Z,9Z)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one | ||
|---|---|---|---|---|
| CAS Number | 67517-37-7 | Molecular Weight | 298.46200 | |
| Density | 0.944g/cm3 | Boiling Point | 432.5ºC at 760 mmHg | |
| Molecular Formula | C21H30O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | (3Z,5Z,7Z,9Z)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.944g/cm3 |
|---|---|
| Boiling Point | 432.5ºC at 760 mmHg |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.46200 |
| Flash Point | 199.4ºC |
| Exact Mass | 298.23000 |
| PSA | 17.07000 |
| LogP | 6.10700 |
| Index of Refraction | 1.536 |
| InChIKey | ZUDVJDSGCWBJDP-DXYSAURFSA-N |
| SMILES | CC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
|
~%
(3Z,5Z,7Z,9Z)-4... CAS#:67517-37-7 |
| Literature: Arens; van Dorp Nature (London, United Kingdom), 1946 , vol. 157, p. 190 |
|
~%
(3Z,5Z,7Z,9Z)-4... CAS#:67517-37-7 |
| Literature: Bassolino, Giovanni; Sovdat, Tina; Liebel, Matz; Schnedermann, Christoph; Odell, Barbara; Claridge, Timothy D.W.; Kukura, Philipp; Fletcher, Stephen P. Journal of the American Chemical Society, 2014 , vol. 136, # 6 p. 2650 - 2658 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| all-trans-retinyl-methyl-ketone |
| retinyl methyl ketone |
| 15-Methyl retinone |
| methyl retinyl ketone |
| all-trans-Retinon |