2,2,2-trifluoro-N'-(2,2,2-trifluoroethanimidoyl)ethanimidamide structure
|
Common Name | 2,2,2-trifluoro-N'-(2,2,2-trifluoroethanimidoyl)ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 675-05-8 | Molecular Weight | 207.07700 | |
| Density | 1.67g/cm3 | Boiling Point | 67ºC at 760 mmHg | |
| Molecular Formula | C4H3F6N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N'-(2,2,2-trifluoroethanimidoyl)ethanimidamide |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 67ºC at 760 mmHg |
| Molecular Formula | C4H3F6N3 |
| Molecular Weight | 207.07700 |
| Exact Mass | 207.02300 |
| PSA | 59.73000 |
| LogP | 2.24550 |
| Index of Refraction | 1.373 |
| InChIKey | XUMRUJGLULMBQP-UHFFFAOYSA-N |
| SMILES | N=C(N=C(N)C(F)(F)F)C(F)(F)F |
| HS Code | 2925290090 |
|---|
|
~%
2,2,2-trifluoro... CAS#:675-05-8 |
| Literature: Brown,H.C.; Schuman,P.D. Journal of Organic Chemistry, 1963 , vol. 28, p. 1122 - 1127 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |