[4-amino-2-(methylamino)-1,3-thiazol-5-yl](4-methylphenyl)methanone structure
|
Common Name | [4-amino-2-(methylamino)-1,3-thiazol-5-yl](4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 674805-68-6 | Molecular Weight | 247.31600 | |
| Density | 1.313g/cm3 | Boiling Point | 474.8ºC at 760 mmHg | |
| Molecular Formula | C12H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241ºC | |
| Name | [4-amino-2-(methylamino)-1,3-thiazol-5-yl](4-methylphenyl)methanone() |
|---|
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 474.8ºC at 760 mmHg |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.31600 |
| Flash Point | 241ºC |
| Exact Mass | 247.07800 |
| PSA | 96.25000 |
| LogP | 2.96060 |
| Index of Refraction | 1.68 |
| InChIKey | RSHMGWLEIDNTBP-UHFFFAOYSA-N |
| SMILES | CNc1nc(N)c(C(=O)c2ccc(C)cc2)s1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |