methyl 2,4-dichloro-3,5-dinitrobenzoate structure
|
Common Name | methyl 2,4-dichloro-3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 67451-32-5 | Molecular Weight | 295.03300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,4-dichloro-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4Cl2N2O6 |
|---|---|
| Molecular Weight | 295.03300 |
| Exact Mass | 293.94500 |
| PSA | 117.94000 |
| LogP | 3.64280 |
| InChIKey | USJCPSDQCYIWDT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Cl |
|
~97%
methyl 2,4-dich... CAS#:67451-32-5 |
| Literature: Fathalla, Magda F.; Hamed, Ezzat A. Journal of Chemical Research, 2006 , # 7 p. 413 - 416 |
|
~%
methyl 2,4-dich... CAS#:67451-32-5 |
| Literature: Fathalla, Magda F.; Hamed, Ezzat A. Journal of Chemical Research, 2006 , # 7 p. 413 - 416 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2,4-dichloro-3,5-dinitro-,methyl ester |