(3-bromophenyl)sulfanyl-phenyl-methanone structure
|
Common Name | (3-bromophenyl)sulfanyl-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 67438-09-9 | Molecular Weight | 293.17900 | |
| Density | 1.53g/cm3 | Boiling Point | 364.8ºC at 760mmHg | |
| Molecular Formula | C13H9BrOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4ºC | |
| Name | m-Bromphenyl-thiobenzoat |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 364.8ºC at 760mmHg |
| Molecular Formula | C13H9BrOS |
| Molecular Weight | 293.17900 |
| Flash Point | 174.4ºC |
| Exact Mass | 291.95600 |
| PSA | 42.37000 |
| LogP | 4.38160 |
| InChIKey | CUWHINUHBVPUQZ-UHFFFAOYSA-N |
| SMILES | O=C(Sc1cccc(Br)c1)c1ccccc1 |
|
~%
(3-bromophenyl)... CAS#:67438-09-9 |
| Literature: Guanti,G. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1978 , p. 422 - 425 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| m-Brom-phenylglyoxal |