4-anilino-2-methoxybenzenediazonium,formaldehyde,chloride structure
|
Common Name | 4-anilino-2-methoxybenzenediazonium,formaldehyde,chloride | ||
|---|---|---|---|---|
| CAS Number | 67325-90-0 | Molecular Weight | 291.73300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-anilino-2-methoxybenzenediazonium,formaldehyde,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14ClN3O2 |
|---|---|
| Molecular Weight | 291.73300 |
| Exact Mass | 291.07700 |
| PSA | 66.48000 |
| LogP | 1.45138 |
| InChIKey | MTHFAFIBOWZRTM-UHFFFAOYSA-M |
| SMILES | C=O.COc1cc(Nc2ccccc2)ccc1[N+]#N.[Cl-] |
| 2-Methoxy-4-(phenylamino)benzenediazonium chloride polymer with formaldehyde |
| Benzenediazonium,2-methoxy-4-(phenylamino)-,chloride (1:1),polymer with formaldehyde |
| Benzenediazonium,2-methoxy-4-(phenylamino)-,chloride,polymer with formaldehyde |