nsc314544 structure
|
Common Name | nsc314544 | ||
|---|---|---|---|---|
| CAS Number | 67277-93-4 | Molecular Weight | 326.04600 | |
| Density | 1.66g/cm3 | Boiling Point | 429.4ºC at 760 mmHg | |
| Molecular Formula | C13H12Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | nsc314544 |
|---|
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 429.4ºC at 760 mmHg |
| Molecular Formula | C13H12Cl4O |
| Molecular Weight | 326.04600 |
| Flash Point | 181.2ºC |
| Exact Mass | 323.96400 |
| PSA | 17.07000 |
| LogP | 3.55910 |
| Index of Refraction | 1.647 |
| InChIKey | GPQWRTFDQOIUNP-UHFFFAOYSA-N |
| SMILES | O=C1C2(Cl)C3CCC4C5CCC3C1(Cl)C5(Cl)C42Cl |
|
~%
nsc314544 CAS#:67277-93-4 |
| Literature: Eaton,P.E.; Chakraborty,U.R. Journal of the American Chemical Society, 1978 , vol. 100, # 11 p. 3634 - 3635 |