(1-dimethoxyphosphorylcyclohexyl)oxy-trimethylsilane structure
|
Common Name | (1-dimethoxyphosphorylcyclohexyl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 67217-11-2 | Molecular Weight | 280.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H25O4PSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-dimethoxyphosphorylcyclohexyl)oxy-trimethylsilane |
|---|
| Molecular Formula | C11H25O4PSi |
|---|---|
| Molecular Weight | 280.37300 |
| Exact Mass | 280.12600 |
| PSA | 54.57000 |
| LogP | 3.98420 |
| InChIKey | IRNBRDQARGGCEE-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C1(O[Si](C)(C)C)CCCCC1 |
|
~73%
(1-dimethoxypho... CAS#:67217-11-2 |
| Literature: Azizi, Najmoddin; Saidi, Mohammad R. Tetrahedron Letters, 2003 , vol. 44, # 43 p. 7933 - 7935 |
|
~%
(1-dimethoxypho... CAS#:67217-11-2 |
| Literature: Evans,D.A. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 3467 - 3477 |