2,3,5-trifluoro-6-(4-hydroxyanilino)benzene-1,4-dicarbonitrile structure
|
Common Name | 2,3,5-trifluoro-6-(4-hydroxyanilino)benzene-1,4-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 67205-71-4 | Molecular Weight | 289.21200 | |
| Density | 1.53g/cm3 | Boiling Point | 361.1ºC at 760 mmHg | |
| Molecular Formula | C14H6F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | 2,3,5-trifluoro-6-(4-hydroxyanilino)benzene-1,4-dicarbonitrile |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 361.1ºC at 760 mmHg |
| Molecular Formula | C14H6F3N3O |
| Molecular Weight | 289.21200 |
| Flash Point | 172.2ºC |
| Exact Mass | 289.04600 |
| PSA | 79.84000 |
| LogP | 3.36946 |
| Index of Refraction | 1.619 |
| InChIKey | XBWYJDXXJPFFRJ-UHFFFAOYSA-N |
| SMILES | N#Cc1c(F)c(F)c(C#N)c(Nc2ccc(O)cc2)c1F |
|
~%
2,3,5-trifluoro... CAS#:67205-71-4 |
| Literature: Heilman; Battershell; Pyne; Goble; Magee Journal of Medicinal Chemistry, 1978 , vol. 21, # 9 p. 906 - 913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |