2,4-dimethyl-3,4-dihydro-2-benzazepine-1,5-dione structure
|
Common Name | 2,4-dimethyl-3,4-dihydro-2-benzazepine-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 67177-37-1 | Molecular Weight | 203.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethyl-3,4-dihydro-2-benzazepine-1,5-dione |
|---|
| Molecular Formula | C12H13NO2 |
|---|---|
| Molecular Weight | 203.23700 |
| Exact Mass | 203.09500 |
| PSA | 37.38000 |
| LogP | 1.52890 |
| InChIKey | FHSKJDJZKASNBB-UHFFFAOYSA-N |
| SMILES | CC1CN(C)C(=O)c2ccccc2C1=O |
|
~44%
2,4-dimethyl-3,... CAS#:67177-37-1 |
| Literature: Mazzocchi, Paul H.; Minamikawa, S.; Wilson, P.; Bowen, M.; Narian, N. Journal of Organic Chemistry, 1981 , vol. 46, # 24 p. 4846 - 4851 |
|
~32%
2,4-dimethyl-3,... CAS#:67177-37-1 |
| Literature: Mazzocchi, Paul H.; Minamikawa, S.; Wilson, P.; Bowen, M.; Narian, N. Journal of Organic Chemistry, 1981 , vol. 46, # 24 p. 4846 - 4851 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |