1-N,1-N,8-N,8-N-tetraethyl-2,7-dimethoxynaphthalene-1,8-diamine structure
|
Common Name | 1-N,1-N,8-N,8-N-tetraethyl-2,7-dimethoxynaphthalene-1,8-diamine | ||
|---|---|---|---|---|
| CAS Number | 67116-12-5 | Molecular Weight | 330.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N,1-N,8-N,8-N-tetraethyl-2,7-dimethoxynaphthalene-1,8-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30N2O2 |
|---|---|
| Molecular Weight | 330.46400 |
| Exact Mass | 330.23100 |
| PSA | 24.94000 |
| LogP | 4.54940 |
| InChIKey | UZLNWBALYYEOPB-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c(OC)ccc2ccc(OC)c(N(CC)CC)c12 |
|
~%
1-N,1-N,8-N,8-N... CAS#:67116-12-5 |
| Literature: Alder, Roger W.; Bryce, Martin R.; Goode, Nigel C.; Miller, Nigel; Owen, Judith Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2840 - 2847 |
| 1,8-Naphthalenediamine,N,N,N',N'-tetraethyl-2,7-dimethoxy |