O-Ethyl S,S-dipropylphosphorodithioic acid ester mixt. with pentachloronitrobenzene
Modify Date: 2025-08-27 14:36:32
O-Ethyl S,S-dipropylphosphorodithioic acid ester mixt. with pentachloronitrobenzene structure
|
Common Name | O-Ethyl S,S-dipropylphosphorodithioic acid ester mixt. with pentachloronitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 67055-46-3 | Molecular Weight | 537.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19Cl5NO4PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O-Ethyl S,S-dipropylphosphorodithioic acid ester mixt. with pentachloronitrobenzene |
|---|
| Molecular Formula | C14H19Cl5NO4PS2 |
|---|---|
| Molecular Weight | 537.7 |
| InChIKey | PPTCCUZHXOOBHO-UHFFFAOYSA-N |
| SMILES | CCCSP(=O)(OCC)SCCC.O=[N+]([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |