5-Butyl-5-ethyl-1-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione structure
|
Common Name | 5-Butyl-5-ethyl-1-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione | ||
|---|---|---|---|---|
| CAS Number | 67050-28-6 | Molecular Weight | 288.34200 | |
| Density | 1.136g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-butyl-5-ethyl-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.34200 |
| Exact Mass | 288.14700 |
| PSA | 69.97000 |
| LogP | 3.19690 |
| Index of Refraction | 1.526 |
| InChIKey | ZGHDFVVXOYKDBZ-UHFFFAOYSA-N |
| SMILES | CCCCC1(CC)C(=O)NC(=O)N(c2ccccc2)C1=O |
|
~%
5-Butyl-5-ethyl... CAS#:67050-28-6 |
| Literature: Buck Journal of the American Chemical Society, 1936 , vol. 58, p. 1284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BARBITURIC ACID,5-BUTYL-5-ETHYL-1-PHENYL |
| 5-ethyl-5-butyl-1-phenyl-barbituric acid |
| 5-Butyl-5-ethyl-1-phenylbarbituric acid |
| 5-Aethyl-5-butyl-1-phenyl-barbitursaeure |