3-(2-methylpiperidin-1-ium-1-yl)propyl 4-phenoxybenzoate,chloride structure
|
Common Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-phenoxybenzoate,chloride | ||
|---|---|---|---|---|
| CAS Number | 67031-66-7 | Molecular Weight | 389.91600 | |
| Density | N/A | Boiling Point | 480.2ºC at 760mmHg | |
| Molecular Formula | C22H28ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.2ºC | |
| Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-phenoxybenzoate,chloride |
|---|
| Boiling Point | 480.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.91600 |
| Flash Point | 244.2ºC |
| Exact Mass | 389.17600 |
| PSA | 38.77000 |
| LogP | 5.64010 |
| InChIKey | YZUVHOBGEOSTLE-UHFFFAOYSA-N |
| SMILES | CC1CCCC[NH+]1CCCOC(=O)c1ccc(Oc2ccccc2)cc1.[Cl-] |
|
~%
3-(2-methylpipe... CAS#:67031-66-7 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
|
~%
3-(2-methylpipe... CAS#:67031-66-7 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |