Benzonitrile,2-[[3-(trifluoromethyl)phenyl]methyl]- structure
|
Common Name | Benzonitrile,2-[[3-(trifluoromethyl)phenyl]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 670-74-6 | Molecular Weight | 261.24200 | |
| Density | 1.25g/cm3 | Boiling Point | 319.4ºC at 760mmHg | |
| Molecular Formula | C15H10F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147ºC | |
| Name | 2-[[3-(trifluoromethyl)phenyl]methyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 319.4ºC at 760mmHg |
| Molecular Formula | C15H10F3N |
| Molecular Weight | 261.24200 |
| Flash Point | 147ºC |
| Exact Mass | 261.07700 |
| PSA | 23.79000 |
| LogP | 4.16788 |
| Index of Refraction | 1.543 |
| InChIKey | MALJONLOQBWIJD-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1Cc1cccc(C(F)(F)F)c1 |
|
~%
Benzonitrile,2-... CAS#:670-74-6 |
| Literature: Vingiello; Van Oot Journal of the American Chemical Society, 1951 , vol. 73, p. 5070 |
|
~%
Benzonitrile,2-... CAS#:670-74-6 |
| Literature: Vingiello; Van Oot Journal of the American Chemical Society, 1951 , vol. 73, p. 5070 |
|
~%
Benzonitrile,2-... CAS#:670-74-6 |
| Literature: Vingiello; Van Oot Journal of the American Chemical Society, 1951 , vol. 73, p. 5070 |
| 2-(3-trifluoromethyl-benzyl)-benzonitrile |
| 2-(3-Trifluormethyl-benzyl)-benzonitril |