THP-PEG8-Tos structure
|
Common Name | THP-PEG8-Tos | ||
|---|---|---|---|---|
| CAS Number | 669556-37-0 | Molecular Weight | 520.63300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H40O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of THP-PEG8-TosTHP-PEG8-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 17-(tetrahydro-2H-pyran-2-yloxy)-3,6,9,12,15-pentaoxaheptadecyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | THP-PEG8-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C24H40O10S |
|---|---|
| Molecular Weight | 520.63300 |
| Exact Mass | 520.23400 |
| PSA | 116.36000 |
| LogP | 3.40730 |
| InChIKey | WGBIVDDINDJYEB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOC2CCCCO2)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 17-[(tetrahydro-2H-pyran-2-yl)oxy]-1-tosyloxy-3,6,9,12,15-pentaoxaheptadecane |
| 1-(2H-tetrahydropyran-2-yloxy)-17-tosyloxy-3,6,9,12,15-pentaoxaheptadecane |