1-(3,4,5-trimethoxybenzoyl)oxyethyl 5-butoxypyridine-2-carboxylate structure
|
Common Name | 1-(3,4,5-trimethoxybenzoyl)oxyethyl 5-butoxypyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 66933-14-0 | Molecular Weight | 433.45200 | |
| Density | 1.186g/cm3 | Boiling Point | 541.1ºC at 760 mmHg | |
| Molecular Formula | C22H27NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4,5-trimethoxybenzoyl)oxyethyl 5-butoxypyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760 mmHg |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.45200 |
| Exact Mass | 433.17400 |
| PSA | 102.41000 |
| LogP | 3.64610 |
| Index of Refraction | 1.529 |
| InChIKey | QUZHZPGDYVOGGM-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C(=O)OC(C)OC(=O)c2cc(OC)c(OC)c(OC)c2)nc1 |
| Picolinic acid,5-butoxy-,1-hydroxyethyl ester,ester with 3,4,5-trimethoxybenzoic acid |
| 5-Butoxypicolinic acid 1-hydroxyethyl ester ester with 3,4,5-trimethoxybenzoic acid |