1-(anthracen-9-ylmethyl)-3-octyl-1,2-dihydroimidazol-1-ium,chloride structure
|
Common Name | 1-(anthracen-9-ylmethyl)-3-octyl-1,2-dihydroimidazol-1-ium,chloride | ||
|---|---|---|---|---|
| CAS Number | 668989-10-4 | Molecular Weight | 409.00700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H33ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(anthracen-9-ylmethyl)-3-octyl-1,2-dihydroimidazol-1-ium,chloride |
|---|
| Molecular Formula | C26H33ClN2 |
|---|---|
| Molecular Weight | 409.00700 |
| Exact Mass | 408.23300 |
| PSA | 6.48000 |
| LogP | 7.57760 |
| InChIKey | TZAOOWMLGMHTTI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C=C[NH+](Cc2c3ccccc3cc3ccccc23)C1.[Cl-] |
|
~89%
1-(anthracen-9-... CAS#:668989-10-4 |
| Literature: Liu, Qing-Xiang; Xu, Feng-Bo; Li, Qing-Shan; Song, Hai-Bin; Zhang, Zheng-Zhi Journal of Molecular Structure, 2004 , vol. 697, # 1-3 p. 131 - 135 |
|
~%
1-(anthracen-9-... CAS#:668989-10-4 |
| Literature: Liu, Qing-Xiang; Xu, Feng-Bo; Li, Qing-Shan; Song, Hai-Bin; Zhang, Zheng-Zhi Journal of Molecular Structure, 2004 , vol. 697, # 1-3 p. 131 - 135 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |