4-nitroaniline structure
|
Common Name | 4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 66827-74-5 | Molecular Weight | 474.82200 | |
| Density | N/A | Boiling Point | 332ºC (calculated) | |
| Molecular Formula | C12H10HgN4O4 | Melting Point | 146ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | mercury(2+),(4-nitrophenyl)azanide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 332ºC (calculated) |
|---|---|
| Melting Point | 146ºC |
| Molecular Formula | C12H10HgN4O4 |
| Molecular Weight | 474.82200 |
| Exact Mass | 476.04100 |
| PSA | 151.32000 |
| LogP | 2.40590 |
| InChIKey | PJOVVJWGULMVNR-UHFFFAOYSA-N |
| SMILES | [Hg+2].[NH-]c1ccc([N+](=O)[O-])cc1.[NH-]c1ccc([N+](=O)[O-])cc1 |
|
~%
4-nitroaniline CAS#:66827-74-5 |
| Literature: Kharasch; Lommen; Jacobsohn Journal of the American Chemical Society, 1922 , vol. 44, p. 801 |
|
~%
4-nitroaniline CAS#:66827-74-5 |
| Literature: Jackson; Peakes American Chemical Journal, 1908 , vol. 39, p. 571 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Nitroaniline mercury deriv |