2(1H)-Quinoxalinone,3,4-dihydro-3-[2-(4-nitrophenyl)-2-oxoethylidene]- structure
|
Common Name | 2(1H)-Quinoxalinone,3,4-dihydro-3-[2-(4-nitrophenyl)-2-oxoethylidene]- | ||
|---|---|---|---|---|
| CAS Number | 66751-91-5 | Molecular Weight | 309.27600 | |
| Density | 1.45g/cm3 | Boiling Point | 565.4ºC at 760 mmHg | |
| Molecular Formula | C16H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.7ºC | |
| Name | (3E)-3-[2-(4-nitrophenyl)-2-oxoethylidene]-1,4-dihydroquinoxalin-2-one |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 565.4ºC at 760 mmHg |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.27600 |
| Flash Point | 295.7ºC |
| Exact Mass | 309.07500 |
| PSA | 111.54000 |
| LogP | 2.23210 |
| Index of Refraction | 1.706 |
| InChIKey | YKACOPNJMPGCAE-DHDCSXOGSA-N |
| SMILES | O=c1[nH]c2ccccc2nc1C=C(O)c1ccc([N+](=O)[O-])cc1 |
|
~%
2(1H)-Quinoxali... CAS#:66751-91-5 |
| Literature: Andreichikov, Yu.S.; Kozlov, A.P.; Kurdina, L.N. Journal of Organic Chemistry USSR (English Translation), 1984 , vol. 20, p. 752 - 756 Zhurnal Organicheskoi Khimii, 1984 , vol. 20, # 4 p. 826 - 831 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |