8-chloro-2-(2-hydroxy-phenyl)-quinoline-4-carboxylic acid structure
|
Common Name | 8-chloro-2-(2-hydroxy-phenyl)-quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 667412-65-9 | Molecular Weight | 299.70900 | |
| Density | 1.462g/cm3 | Boiling Point | 515.7ºC at 760 mmHg | |
| Molecular Formula | C16H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7ºC | |
| Name | 8-chloro-2-(2-hydroxy-phenyl)-quinoline-4-carboxylic acid |
|---|
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 515.7ºC at 760 mmHg |
| Molecular Formula | C16H10ClNO3 |
| Molecular Weight | 299.70900 |
| Flash Point | 265.7ºC |
| Exact Mass | 299.03500 |
| PSA | 70.42000 |
| LogP | 3.95900 |
| Index of Refraction | 1.714 |
| InChIKey | KVFZPSDQSZKXFB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2O)nc2c(Cl)cccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |