α-Methyl-4-(1-methylethyl)benzenepropanoic acid
Modify Date: 2025-09-13 18:25:55
α-Methyl-4-(1-methylethyl)benzenepropanoic acid structure
|
Common Name | α-Methyl-4-(1-methylethyl)benzenepropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 66735-06-6 | Molecular Weight | 206.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | p-isopropyl-α-methyl-hydroxycinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O2 |
|---|---|
| Molecular Weight | 206.28100 |
| Exact Mass | 206.13100 |
| PSA | 37.30000 |
| LogP | 3.07320 |
| InChIKey | FLMVHZOJMRGXRO-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc(C(C)C)cc1)C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(4-isopropylphenyl)-2-methylpropanoic acid |
| 3-(4-isopropyl-phenyl)-2-methyl-propionic acid |
| 3-(4-Isopropyl-phenyl)-2-methyl-propionsaeure |