Cyclohexanecarbonyl chloride, 3-chloro-1,3-dimethyl- (9CI)
Modify Date: 2025-08-26 14:10:30
Cyclohexanecarbonyl chloride, 3-chloro-1,3-dimethyl- (9CI) structure
|
Common Name | Cyclohexanecarbonyl chloride, 3-chloro-1,3-dimethyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 66684-49-9 | Molecular Weight | 209.11300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-1,3-dimethylcyclohexane-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14Cl2O |
|---|---|
| Molecular Weight | 209.11300 |
| Exact Mass | 208.04200 |
| PSA | 17.07000 |
| LogP | 3.32960 |
| InChIKey | RVHVHWSEDGEMPA-UHFFFAOYSA-N |
| SMILES | CC1(Cl)CCCC(C)(C(=O)Cl)C1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-chloro-1,3-dimethyl-cyclohexanecarbonyl chloride |