1,2-bis(2,2-dimethylpropyl)-3,4,5,6-tetramethyl-benzene structure
|
Common Name | 1,2-bis(2,2-dimethylpropyl)-3,4,5,6-tetramethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 6668-20-8 | Molecular Weight | 274.48400 | |
| Density | 0.859g/cm3 | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C20H34 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 1,2-bis(2,2-dimethylpropyl)-3,4,5,6-tetramethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 352.7ºC at 760 mmHg |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.48400 |
| Flash Point | 167.4ºC |
| Exact Mass | 274.26600 |
| LogP | 6.09740 |
| Index of Refraction | 1.49 |
| InChIKey | ULDLEROKNIHNLZ-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(CC(C)(C)C)c(CC(C)(C)C)c1C |
|
~%
1,2-bis(2,2-dim... CAS#:6668-20-8 |
| Literature: Newman,M.S. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 868 - 872 |
| 1,2,3,4-tetramethyl-5,6-dineopentylbenzene |
| Dineopentylprehnitene |
| 1,2,3,4-Tetramethyl-5,6-bis-<(2,2-dimethyl-propyl)>-benzol |
| 1.2-Dineopentyltetramethylbenzol |
| 1,2-dineopentyl-3,4,5,6-tetramethylbenzene |
| 1,2-dineopentyltetramethylbenzene |
| o-dineopentyltetramethylbenzene |
| Benzene,1,2,3,4-tetramethyl-5,6-dineopentyl |
| Benzene,1,2-bis(2,2-dimethylpropyl)-3,4,5,6-tetramethyl |