3,12-dihydroxyhexadecanoic acid
Modify Date: 2025-08-26 05:56:41
3,12-dihydroxyhexadecanoic acid structure
|
Common Name | 3,12-dihydroxyhexadecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 66675-73-8 | Molecular Weight | 288.42300 | |
| Density | 1.019g/cm3 | Boiling Point | 445.6ºC at 760 mmHg | |
| Molecular Formula | C16H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.4ºC | |
| Name | 3,12-dihydroxyhexadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 445.6ºC at 760 mmHg |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.42300 |
| Flash Point | 237.4ºC |
| Exact Mass | 288.23000 |
| PSA | 77.76000 |
| LogP | 3.49390 |
| Index of Refraction | 1.482 |
| InChIKey | FEIUPFRYFFTGFY-UHFFFAOYSA-N |
| SMILES | CCCCC(O)CCCCCCCCC(O)CC(=O)O |
| HS Code | 2918199090 |
|---|
|
~%
3,12-dihydroxyh... CAS#:66675-73-8 |
| Literature: Votocek; Prelog Collection of Czechoslovak Chemical Communications, vol. 1, p. 58 Chem. Zentralbl., 1929 , vol. 100, # II p. 579 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:57-10-3
CAS#:86497-44-1
CAS#:64-19-7| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3,12-dihydroxy-hexadecanoic acid |
| 3,12-Dihydroxy-hexadecansaeure |
| Hexadecanoic acid,3,12-dihydroxy |
| 3,12-dihydroxy palmitic acid |