3-BENZO[B]FURAN-2-YL-1H-PYRAZOLE structure
|
Common Name | 3-BENZO[B]FURAN-2-YL-1H-PYRAZOLE | ||
|---|---|---|---|---|
| CAS Number | 666728-39-8 | Molecular Weight | 184.19400 | |
| Density | 1.286g/cm3 | Boiling Point | 406.2ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 5-(1-benzofuran-2-yl)-1H-pyrazole |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 406.2ºC at 760 mmHg |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.19400 |
| Flash Point | 213.5ºC |
| Exact Mass | 184.06400 |
| PSA | 41.82000 |
| LogP | 2.82290 |
| Index of Refraction | 1.67 |
| InChIKey | AACMKKWADJBYOE-UHFFFAOYSA-N |
| SMILES | c1ccc2oc(-c3ccn[nH]3)cc2c1 |
| HS Code | 2934999090 |
|---|
|
~%
3-BENZO[B]FURAN... CAS#:666728-39-8 |
| Literature: Abbas, Eman M. H. Egyptian Journal of Chemistry, 2009 , vol. 52, # 5 p. 655 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |