3-hydroxy-5-methoxyflavone structure
|
Common Name | 3-hydroxy-5-methoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 6665-81-2 | Molecular Weight | 268.26400 | |
| Density | 1.353g/cm3 | Boiling Point | 448ºC at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | 173-176ºC | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | 3-hydroxy-5-methoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 448ºC at 760 mmHg |
| Melting Point | 173-176ºC |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 170ºC |
| Exact Mass | 268.07400 |
| PSA | 59.67000 |
| LogP | 3.17420 |
| Index of Refraction | 1.651 |
| InChIKey | WHLQVYWQNZFUPW-UHFFFAOYSA-N |
| SMILES | COc1cccc2oc(-c3ccccc3)c(O)c(=O)c12 |
| HS Code | 2914509090 |
|---|
|
~%
3-hydroxy-5-met... CAS#:6665-81-2 |
| Literature: Oliverio; Schiavello Gazzetta Chimica Italiana, 1950 , vol. 80, p. 788,791 |
|
~%
3-hydroxy-5-met... CAS#:6665-81-2 |
| Literature: Seshadri; Venkateswarlu Proceedings - Indian Academy of Sciences, Section A, 1947 , # 26 p. 189,191 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-hydroxy-5-methoxy-2-phenyl-chromen-4-one |
| METHOXYFLAVONOL,5 |
| 5-methoxy-3-hydroxyflavone |
| 5-methoxyflavonol |
| 3-Hydroxy-5-methoxy-4-oxo-2-phenyl-4H-chromen |
| 3-Hydroxy-5-methoxy-2-phenyl-chromen-4-on |