N,N,N'-Tri(beta-chloroethyl)-N'-(4-formylphenyl)-1,3-propylenediamine
Modify Date: 2025-09-05 06:59:09
N,N,N'-Tri(beta-chloroethyl)-N'-(4-formylphenyl)-1,3-propylenediamine structure
|
Common Name | N,N,N'-Tri(beta-chloroethyl)-N'-(4-formylphenyl)-1,3-propylenediamine | ||
|---|---|---|---|---|
| CAS Number | 66648-37-1 | Molecular Weight | 365.72600 | |
| Density | 1.235g/cm3 | Boiling Point | 448ºC at 760 mmHg | |
| Molecular Formula | C16H23Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7ºC | |
| Name | 4-[3-[bis(2-chloroethyl)amino]propyl-(2-chloroethyl)amino]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 448ºC at 760 mmHg |
| Molecular Formula | C16H23Cl3N2O |
| Molecular Weight | 365.72600 |
| Flash Point | 224.7ºC |
| Exact Mass | 364.08800 |
| PSA | 23.55000 |
| LogP | 3.71400 |
| Index of Refraction | 1.576 |
| InChIKey | DHYSDJTVLQLIDM-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(N(CCCl)CCCN(CCCl)CCCl)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N,N'-Tfp |