4-methylsulfonyl-2,4',5-trichlorobiphenyl
Modify Date: 2025-09-22 05:51:51
4-methylsulfonyl-2,4',5-trichlorobiphenyl structure
|
Common Name | 4-methylsulfonyl-2,4',5-trichlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 66640-67-3 | Molecular Weight | 335.63300 | |
| Density | 1.444g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | 1,4-dichloro-2-(4-chlorophenyl)-5-methylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Molecular Formula | C13H9Cl3O2S |
| Molecular Weight | 335.63300 |
| Flash Point | 242.1ºC |
| Exact Mass | 333.93900 |
| PSA | 42.52000 |
| LogP | 5.79810 |
| Index of Refraction | 1.599 |
| InChIKey | XICMUQMUKALQAT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(Cl)c(-c2ccc(Cl)cc2)cc1Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methylsulfonyl-2,4',5-trichlorbiphenyl |
| 4-Methylsulfonyl-2,4',5-trichlorobiphenyl |