pentan-3-yl 3,5-dinitrobenzoate structure
|
Common Name | pentan-3-yl 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 66591-32-0 | Molecular Weight | 282.24900 | |
| Density | 1.298g/cm3 | Boiling Point | 395.4ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 3-Pentyl-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760 mmHg |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.24900 |
| Flash Point | 165.5ºC |
| Exact Mass | 282.08500 |
| PSA | 117.94000 |
| LogP | 3.89480 |
| Index of Refraction | 1.553 |
| InChIKey | XCFUOXLGQPIUEG-UHFFFAOYSA-N |
| SMILES | CCC(CC)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
pentan-3-yl 3,5... CAS#:66591-32-0 |
| Literature: Conant; Blatt Journal of the American Chemical Society, 1929 , vol. 51, p. 1233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Pentyl-<3,5-dinitro-benzoat> |
| Pentan-3-ol-<3,5-dinitro-benzoat> |
| 3-Butyn-2-ol,2-methyl-,3,5-dinitrobenzoate |