9,10-Phenanthrenequinone (2,4-dinitrophenyl)hydrazone
Modify Date: 2025-08-27 22:32:28
9,10-Phenanthrenequinone (2,4-dinitrophenyl)hydrazone structure
|
Common Name | 9,10-Phenanthrenequinone (2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 66591-20-6 | Molecular Weight | 388.33300 | |
| Density | 1.5g/cm3 | Boiling Point | 625.4ºC at 760 mmHg | |
| Molecular Formula | C20H12N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332ºC | |
| Name | 9,10-Phenanthrenequinone (2,4-dinitrophenyl)hydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 625.4ºC at 760 mmHg |
| Molecular Formula | C20H12N4O5 |
| Molecular Weight | 388.33300 |
| Flash Point | 332ºC |
| Exact Mass | 388.08100 |
| PSA | 133.10000 |
| LogP | 5.30190 |
| Index of Refraction | 1.729 |
| InChIKey | WIWQKZWDFCJGQY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2c(O)c3ccccc3c3ccccc23)c([N+](=O)[O-])c1 |
|
~90%
9,10-Phenanthre... CAS#:66591-20-6 |
| Literature: Stankyavichyus; Yanushene; Skiryus Russian Journal of Organic Chemistry, 2007 , vol. 43, # 12 p. 1876 - 1877 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| DNAF |
| 10-(2,4-dinitrophenylhydrazono)-9,10-dihydrophenanthren-9-one |
| 10-(2,4-dinitro-phenylazo)-[9]phenanthrol |