4-phenyl-3-trimethylsilylbutan-2-one structure
|
Common Name | 4-phenyl-3-trimethylsilylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 66581-82-6 | Molecular Weight | 220.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-phenyl-3-trimethylsilylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20OSi |
|---|---|
| Molecular Weight | 220.38300 |
| Exact Mass | 220.12800 |
| PSA | 17.07000 |
| LogP | 3.52650 |
| InChIKey | AMXJKIOEWVAXCF-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Cc1ccccc1)[Si](C)(C)C |
|
~96%
4-phenyl-3-trim... CAS#:66581-82-6 |
| Literature: Sato, Toshio; Matsumoto, Kazuhisa; Abe, Toru; Kuwajima, Isao Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 8 p. 2167 - 2170 |
|
~%
4-phenyl-3-trim... CAS#:66581-82-6 |
| Literature: Sato,T. et al. Tetrahedron Letters, 1978 , p. 259 - 262 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Phenyl-3-trimethylsilyl-butan-2-on |
| 2-Butanone,4-phenyl-3-(trimethylsilyl) |
| 4-phenyl-3-(trimethylsilyl)-2-butanone |