N,N'-ethylenebis[N-(carboxymethyl)glycine], compound with 2,2',2''-nitrilotri(ethanol) structure
|
Common Name | N,N'-ethylenebis[N-(carboxymethyl)glycine], compound with 2,2',2''-nitrilotri(ethanol) | ||
|---|---|---|---|---|
| CAS Number | 66558-66-5 | Molecular Weight | 441.43100 | |
| Density | N/A | Boiling Point | 506ºC at 760 mmHg | |
| Molecular Formula | C16H31N3O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.8ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-[2-[carboxymethyl(methoxycarbonyl)amino]ethyl-methoxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 506ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H31N3O11 |
| Molecular Weight | 441.43100 |
| Flash Point | 259.8ºC |
| Exact Mass | 441.19600 |
| PSA | 197.61000 |
| InChIKey | JLGHBEWZZPXDCT-UHFFFAOYSA-N |
| SMILES | COC(=O)N(CCN(CC(=O)O)C(=O)OC)CC(=O)O.OCCN(CCO)CCO |
| Ethylenediaminetetraacetic acid,triethanolamine salt |
| Ethylenediaminetetraacetic acid,compd. with triethanolamine |
| N,N'-Ethylenebis(N-(carboxymethyl)glycine),compound with 2,2',2''-nitrilotri(ethanol) |
| 2,2'-{ethane-1,2-diylbis[(methoxycarbonyl)imino]}diacetic acid-2,2',2''-nitrilotriethanol(1:1)(non-preferred name) |
| EINECS 266-406-7 |
| Ethylenediamintetraacetic acid,triethanolamine salt |