methyl 3-(2-methoxyphenyl)-2-phenyl-propanoate
Modify Date: 2025-10-03 19:47:57
methyl 3-(2-methoxyphenyl)-2-phenyl-propanoate structure
|
Common Name | methyl 3-(2-methoxyphenyl)-2-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 6641-77-6 | Molecular Weight | 270.32300 | |
| Density | 1.106g/cm3 | Boiling Point | 354.2ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.5ºC | |
| Name | methyl 3-(2-methoxyphenyl)-2-phenylpropanoate |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 354.2ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 147.5ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.19450 |
| Index of Refraction | 1.551 |
| InChIKey | WAGYIRADPNLCOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1OC)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 3-(2-met... CAS#:6641-77-6 |
| Literature: Alexander; Barthel Journal of Organic Chemistry, 1958 , vol. 23, p. 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |