Phenol,4-chloro-2,6-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]- structure
|
Common Name | Phenol,4-chloro-2,6-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6640-95-5 | Molecular Weight | 396.90700 | |
| Density | 1.238g/cm3 | Boiling Point | 556.8ºC at 760 mmHg | |
| Molecular Formula | C24H25ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.5ºC | |
| Name | 2-[[5-chloro-2-hydroxy-3-[(2-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-4,6-dimethylphenol |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 556.8ºC at 760 mmHg |
| Molecular Formula | C24H25ClO3 |
| Molecular Weight | 396.90700 |
| Flash Point | 290.5ºC |
| Exact Mass | 396.14900 |
| PSA | 60.69000 |
| LogP | 5.87200 |
| Index of Refraction | 1.634 |
| InChIKey | JQFAJTWMDXQZOR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(Cl)cc(Cc3cc(C)cc(C)c3O)c2O)c1 |
| HS Code | 2908199090 |
|---|
|
~%
Phenol,4-chloro... CAS#:6640-95-5 |
| Literature: Zigeuner; Elbel Monatshefte fuer Chemie, 1957 , vol. 88, p. 622,628 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |